C10H16O3 — CID 124676375
2-[(3aR,4S,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]acetic acid (PubChem CID 124676375) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is 2-[(3aR,4S,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]acetic acid.
| Compound Name | 2-[(3aR,4S,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]acetic acid |
|---|---|
| PubChem CID | 124676375 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 2-[(3aR,4S,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]acetic acid |
| SMILES | O=C(O)C[C@@H]1CCC[C@@H]2OCC[C@H]12 |
| InChI | InChI=1S/C10H16O3/c11-10(12)6-7-2-1-3-9-8(7)4-5-13-9/h7-9H,1-6H2,(H,11,12)/t7-,8+,9-/m0/s1 |
| InChIKey | GVLLJIHBYFZDAF-YIZRAAEISA-N |
| XLogP | 1.67 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |