C9H16O2 — CID 124676363
[(3aR,4R,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]methanol (PubChem CID 124676363) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is [(3aR,4R,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]methanol.
| Compound Name | [(3aR,4R,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]methanol |
|---|---|
| PubChem CID | 124676363 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | [(3aR,4R,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]methanol |
| SMILES | OC[C@@H]1CCC[C@@H]2OCC[C@H]12 |
| InChI | InChI=1S/C9H16O2/c10-6-7-2-1-3-9-8(7)4-5-11-9/h7-10H,1-6H2/t7-,8+,9-/m0/s1 |
| InChIKey | FKYZTQWCZSHNHM-YIZRAAEISA-N |
| XLogP | 1.18 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |