C7H14ClNO2 — CID 117225597
2-(oxolan-3-yl)-1,3-oxazolidine;hydrochloride (PubChem CID 117225597) has the molecular formula C7H14ClNO2 and a molecular weight of 179.65 g/mol. Its IUPAC name is 2-(oxolan-3-yl)-1,3-oxazolidine;hydrochloride.
| Compound Name | 2-(oxolan-3-yl)-1,3-oxazolidine;hydrochloride |
|---|---|
| PubChem CID | 117225597 |
| Molecular Formula | C7H14ClNO2 |
| Molecular Weight | 179.65 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 2-(oxolan-3-yl)-1,3-oxazolidine;hydrochloride |
| SMILES | C1COC(C2CCOC2)N1.Cl |
| InChI | InChI=1S/C7H13NO2.ClH/c1-3-9-5-6(1)7-8-2-4-10-7;/h6-8H,1-5H2;1H |
| InChIKey | UJIPXDNBRKNOBT-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.65 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |