C7H13NO — CID 68902591
1,2,3,3a,4,5,7,7a-octahydropyrano[3,4-b]pyrrole (PubChem CID 68902591) has the molecular formula C7H13NO and a molecular weight of 127.19 g/mol. Its IUPAC name is 1,2,3,3a,4,5,7,7a-octahydropyrano[3,4-b]pyrrole.
| Compound Name | 1,2,3,3a,4,5,7,7a-octahydropyrano[3,4-b]pyrrole |
|---|---|
| PubChem CID | 68902591 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | 1,2,3,3a,4,5,7,7a-octahydropyrano[3,4-b]pyrrole |
| SMILES | C1CC2CCOCC2N1 |
| InChI | InChI=1S/C7H13NO/c1-3-8-7-5-9-4-2-6(1)7/h6-8H,1-5H2 |
| InChIKey | RGAVPGPIIGQZCC-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |