About 2-(oxolan-3-yl)-1,3-thiazinane
2-(oxolan-3-yl)-1,3-thiazinane (PubChem CID 66218262) has the molecular formula C8H15NOS
and a molecular weight of 173.28 g/mol. Its IUPAC name is 2-(oxolan-3-yl)-1,3-thiazinane.
Molecular Properties
| Compound Name | 2-(oxolan-3-yl)-1,3-thiazinane |
| PubChem CID | 66218262 |
| Molecular Formula | C8H15NOS |
| Molecular Weight | 173.28 g/mol |
| Exact Mass | 173.09 |
| IUPAC Name | 2-(oxolan-3-yl)-1,3-thiazinane |
| SMILES | C1CNC(C2CCOC2)SC1 |
| InChI | InChI=1S/C8H15NOS/c1-3-9-8(11-5-1)7-2-4-10-6-7/h7-9H,1-6H2 |
| InChIKey | UXLPVXINEVPTJU-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.28 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(oxolan-3-yl)-1,3-thiazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxolan-3-yl)-1,3-thiazinane?
The IUPAC name of 2-(oxolan-3-yl)-1,3-thiazinane (CID 66218262) is 2-(oxolan-3-yl)-1,3-thiazinane.
What is the SMILES notation for 2-(oxolan-3-yl)-1,3-thiazinane?
The canonical SMILES for 2-(oxolan-3-yl)-1,3-thiazinane is C1CNC(C2CCOC2)SC1.
What is the InChIKey of 2-(oxolan-3-yl)-1,3-thiazinane?
The InChIKey is UXLPVXINEVPTJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NOS/c1-3-9-8(11-5-1)7-2-4-10-6-7/h7-9H,1-6H2.
What are the key properties of 2-(oxolan-3-yl)-1,3-thiazinane?
2-(oxolan-3-yl)-1,3-thiazinane has a molecular weight of 173.28 g/mol, XLogP of 1.08, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxolan-3-yl)-1,3-thiazinane is sourced from PubChem (CID 66218262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).