About 3-cyclopropyl-2-methyl-1,4-thiazepane
3-cyclopropyl-2-methyl-1,4-thiazepane (PubChem CID 66218764) has the molecular formula C9H17NS
and a molecular weight of 171.31 g/mol. Its IUPAC name is 3-cyclopropyl-2-methyl-1,4-thiazepane.
Molecular Properties
| Compound Name | 3-cyclopropyl-2-methyl-1,4-thiazepane |
| PubChem CID | 66218764 |
| Molecular Formula | C9H17NS |
| Molecular Weight | 171.31 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | 3-cyclopropyl-2-methyl-1,4-thiazepane |
| SMILES | CC1SCCCNC1C1CC1 |
| InChI | InChI=1S/C9H17NS/c1-7-9(8-3-4-8)10-5-2-6-11-7/h7-10H,2-6H2,1H3 |
| InChIKey | LBZXXARXOYLXAX-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.31 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-cyclopropyl-2-methyl-1,4-thiazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropyl-2-methyl-1,4-thiazepane?
The IUPAC name of 3-cyclopropyl-2-methyl-1,4-thiazepane (CID 66218764) is 3-cyclopropyl-2-methyl-1,4-thiazepane.
What is the SMILES notation for 3-cyclopropyl-2-methyl-1,4-thiazepane?
The canonical SMILES for 3-cyclopropyl-2-methyl-1,4-thiazepane is CC1SCCCNC1C1CC1.
What is the InChIKey of 3-cyclopropyl-2-methyl-1,4-thiazepane?
The InChIKey is LBZXXARXOYLXAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NS/c1-7-9(8-3-4-8)10-5-2-6-11-7/h7-10H,2-6H2,1H3.
What are the key properties of 3-cyclopropyl-2-methyl-1,4-thiazepane?
3-cyclopropyl-2-methyl-1,4-thiazepane has a molecular weight of 171.31 g/mol, XLogP of 1.88, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropyl-2-methyl-1,4-thiazepane is sourced from PubChem (CID 66218764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).