C18H33N — CID 162503082
8-(2,3,4,5-tetramethylcyclopentyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline (PubChem CID 162503082) has the molecular formula C18H33N and a molecular weight of 263.47 g/mol. Its IUPAC name is 8-(2,3,4,5-tetramethylcyclopentyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline.
| Compound Name | 8-(2,3,4,5-tetramethylcyclopentyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline |
|---|---|
| PubChem CID | 162503082 |
| Molecular Formula | C18H33N |
| Molecular Weight | 263.47 g/mol |
| Exact Mass | 263.26 |
| IUPAC Name | 8-(2,3,4,5-tetramethylcyclopentyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline |
| SMILES | CC1C(C)C(C)C(C2CCCC3CCCNC32)C1C |
| InChI | InChI=1S/C18H33N/c1-11-12(2)14(4)17(13(11)3)16-9-5-7-15-8-6-10-19-18(15)16/h11-19H,5-10H2,1-4H3 |
| InChIKey | LMFSQDFMLCBIMQ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.47 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |