C13H29N — CID 157051839
5,7-dimethyl-2,3,4,4a,5,6,7,7a-octahydro-1H-cyclopenta[b]pyridine;ethane;methane (PubChem CID 157051839) has the molecular formula C13H29N and a molecular weight of 199.38 g/mol. Its IUPAC name is 5,7-dimethyl-2,3,4,4a,5,6,7,7a-octahydro-1H-cyclopenta[b]pyridine;ethane;methane.
| Compound Name | 5,7-dimethyl-2,3,4,4a,5,6,7,7a-octahydro-1H-cyclopenta[b]pyridine;ethane;methane |
|---|---|
| PubChem CID | 157051839 |
| Molecular Formula | C13H29N |
| Molecular Weight | 199.38 g/mol |
| Exact Mass | 199.23 |
| IUPAC Name | 5,7-dimethyl-2,3,4,4a,5,6,7,7a-octahydro-1H-cyclopenta[b]pyridine;ethane;methane |
| SMILES | C.CC.CC1CC(C)C2NCCCC12 |
| InChI | InChI=1S/C10H19N.C2H6.CH4/c1-7-6-8(2)10-9(7)4-3-5-11-10;1-2;/h7-11H,3-6H2,1-2H3;1-2H3;1H4 |
| InChIKey | AAHJNVXIQPYCNM-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |