C9H15I2NO — CID 140551820
5,7-diiodo-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-8-ol (PubChem CID 140551820) has the molecular formula C9H15I2NO and a molecular weight of 407.03 g/mol. Its IUPAC name is 5,7-diiodo-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-8-ol.
| Compound Name | 5,7-diiodo-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-8-ol |
|---|---|
| PubChem CID | 140551820 |
| Molecular Formula | C9H15I2NO |
| Molecular Weight | 407.03 g/mol |
| Exact Mass | 406.92 |
| IUPAC Name | 5,7-diiodo-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-8-ol |
| SMILES | OC1C(I)CC(I)C2CCCNC12 |
| InChI | InChI=1S/C9H15I2NO/c10-6-4-7(11)9(13)8-5(6)2-1-3-12-8/h5-9,12-13H,1-4H2 |
| InChIKey | KPPWBNVPJCPANW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.03 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|