C9H17NO3 — CID 11008650
(4aS,5R,6R,7S,8aR)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline-5,6,7-triol (PubChem CID 11008650) has the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. Its IUPAC name is (4aS,5R,6R,7S,8aR)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline-5,6,7-triol.
| Compound Name | (4aS,5R,6R,7S,8aR)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline-5,6,7-triol |
|---|---|
| PubChem CID | 11008650 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | (4aS,5R,6R,7S,8aR)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline-5,6,7-triol |
| SMILES | O[C@H]1[C@H](O)[C@@H](O)C[C@H]2NCCC[C@H]12 |
| InChI | InChI=1S/C9H17NO3/c11-7-4-6-5(2-1-3-10-6)8(12)9(7)13/h5-13H,1-4H2/t5-,6+,7-,8+,9+/m0/s1 |
| InChIKey | ZSNOQBLPVLDPKI-KVEIKIFDSA-N |
| XLogP | -1.16 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |