C8H15NO3 — CID 85299300
2,3,3a,4,5,6,7,7a-octahydro-1H-indole-4,5,6-triol (PubChem CID 85299300) has the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. Its IUPAC name is 2,3,3a,4,5,6,7,7a-octahydro-1H-indole-4,5,6-triol.
| Compound Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-indole-4,5,6-triol |
|---|---|
| PubChem CID | 85299300 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-indole-4,5,6-triol |
| SMILES | OC1CC2NCCC2C(O)C1O |
| InChI | InChI=1S/C8H15NO3/c10-6-3-5-4(1-2-9-5)7(11)8(6)12/h4-12H,1-3H2 |
| InChIKey | FUPUZAOGGWQTTI-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |