C22H27NO3 — CID 102081104
(3aS,4S,5R,6R,7aS)-4,5-bis(phenylmethoxy)-2,3,3a,4,5,6,7,7a-octahydro-1H-indol-6-ol (PubChem CID 102081104) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is (3aS,4S,5R,6R,7aS)-4,5-bis(phenylmethoxy)-2,3,3a,4,5,6,7,7a-octahydro-1H-indol-6-ol.
| Compound Name | (3aS,4S,5R,6R,7aS)-4,5-bis(phenylmethoxy)-2,3,3a,4,5,6,7,7a-octahydro-1H-indol-6-ol |
|---|---|
| PubChem CID | 102081104 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | (3aS,4S,5R,6R,7aS)-4,5-bis(phenylmethoxy)-2,3,3a,4,5,6,7,7a-octahydro-1H-indol-6-ol |
| SMILES | OC1C[C@@H]2NCC[C@@H]2[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C22H27NO3/c24-20-13-19-18(11-12-23-19)21(25-14-16-7-3-1-4-8-16)22(20)26-15-17-9-5-2-6-10-17/h1-10,18-24H,11-15H2/t18-,19-,20?,21-,22+/m0/s1 |
| InChIKey | LNSURANHSDVNSM-YSMCHUBRSA-N |
| XLogP | 2.90 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |