C10H18N2O — CID 130353148
8-oxa-6,10-diazatricyclo[7.4.0.02,7]tridecane (PubChem CID 130353148) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is 8-oxa-6,10-diazatricyclo[7.4.0.02,7]tridecane.
| Compound Name | 8-oxa-6,10-diazatricyclo[7.4.0.02,7]tridecane |
|---|---|
| PubChem CID | 130353148 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | 8-oxa-6,10-diazatricyclo[7.4.0.02,7]tridecane |
| SMILES | C1CNC2OC3NCCCC3C2C1 |
| InChI | InChI=1S/C10H18N2O/c1-3-7-8-4-2-6-12-10(8)13-9(7)11-5-1/h7-12H,1-6H2 |
| InChIKey | HPEOOYLEMKSNCI-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |