C8H15NS2 — CID 107133550
2-(thiolan-3-yl)-1,3-thiazinane (PubChem CID 107133550) has the molecular formula C8H15NS2 and a molecular weight of 189.35 g/mol. Its IUPAC name is 2-(thiolan-3-yl)-1,3-thiazinane.
| Compound Name | 2-(thiolan-3-yl)-1,3-thiazinane |
|---|---|
| PubChem CID | 107133550 |
| Molecular Formula | C8H15NS2 |
| Molecular Weight | 189.35 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | 2-(thiolan-3-yl)-1,3-thiazinane |
| SMILES | C1CNC(C2CCSC2)SC1 |
| InChI | InChI=1S/C8H15NS2/c1-3-9-8(11-4-1)7-2-5-10-6-7/h7-9H,1-6H2 |
| InChIKey | NRRADYYDNBUFTI-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.35 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |