C7H13NS — CID 96733476
(3aS,7aR)-1,2,3,3a,4,5,7,7a-octahydrothiopyrano[3,4-b]pyrrole (PubChem CID 96733476) has the molecular formula C7H13NS and a molecular weight of 143.25 g/mol. Its IUPAC name is (3aS,7aR)-1,2,3,3a,4,5,7,7a-octahydrothiopyrano[3,4-b]pyrrole.
| Compound Name | (3aS,7aR)-1,2,3,3a,4,5,7,7a-octahydrothiopyrano[3,4-b]pyrrole |
|---|---|
| PubChem CID | 96733476 |
| Molecular Formula | C7H13NS |
| Molecular Weight | 143.25 g/mol |
| Exact Mass | 143.08 |
| IUPAC Name | (3aS,7aR)-1,2,3,3a,4,5,7,7a-octahydrothiopyrano[3,4-b]pyrrole |
| SMILES | C1C[C@H]2CCSC[C@@H]2N1 |
| InChI | InChI=1S/C7H13NS/c1-3-8-7-5-9-4-2-6(1)7/h6-8H,1-5H2/t6-,7-/m0/s1 |
| InChIKey | FUPTWIHZVZZJGP-BQBZGAKWSA-N |
| XLogP | 1.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.25 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |