C7H13NOS — CID 118210421
1,2,3,5,5a,6,8,8a-octahydrofuro[3,4-e][1,4]thiazepine (PubChem CID 118210421) has the molecular formula C7H13NOS and a molecular weight of 159.25 g/mol. Its IUPAC name is 1,2,3,5,5a,6,8,8a-octahydrofuro[3,4-e][1,4]thiazepine.
| Compound Name | 1,2,3,5,5a,6,8,8a-octahydrofuro[3,4-e][1,4]thiazepine |
|---|---|
| PubChem CID | 118210421 |
| Molecular Formula | C7H13NOS |
| Molecular Weight | 159.25 g/mol |
| Exact Mass | 159.07 |
| IUPAC Name | 1,2,3,5,5a,6,8,8a-octahydrofuro[3,4-e][1,4]thiazepine |
| SMILES | C1CSCC2COCC2N1 |
| InChI | InChI=1S/C7H13NOS/c1-2-10-5-6-3-9-4-7(6)8-1/h6-8H,1-5H2 |
| InChIKey | ZLKDSWLAYVQYCO-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.25 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |