C6H11NOS — CID 118210514
3,4,4a,5,7,7a-hexahydro-2H-furo[3,4-b][1,4]thiazine (PubChem CID 118210514) has the molecular formula C6H11NOS and a molecular weight of 145.23 g/mol. Its IUPAC name is 3,4,4a,5,7,7a-hexahydro-2H-furo[3,4-b][1,4]thiazine.
| Compound Name | 3,4,4a,5,7,7a-hexahydro-2H-furo[3,4-b][1,4]thiazine |
|---|---|
| PubChem CID | 118210514 |
| Molecular Formula | C6H11NOS |
| Molecular Weight | 145.23 g/mol |
| Exact Mass | 145.06 |
| IUPAC Name | 3,4,4a,5,7,7a-hexahydro-2H-furo[3,4-b][1,4]thiazine |
| SMILES | C1CSC2COCC2N1 |
| InChI | InChI=1S/C6H11NOS/c1-2-9-6-4-8-3-5(6)7-1/h5-7H,1-4H2 |
| InChIKey | UOXHMLAZRFKEIZ-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.23 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |