About 4-ethyl-2,3,4a,5,7,7a-hexahydro-1H-furo[3,4-b]pyrazine
4-ethyl-2,3,4a,5,7,7a-hexahydro-1H-furo[3,4-b]pyrazine (PubChem CID 170737886) has the molecular formula C8H16N2O
and a molecular weight of 156.23 g/mol. Its IUPAC name is 4-ethyl-2,3,4a,5,7,7a-hexahydro-1H-furo[3,4-b]pyrazine.
Analyze 4-ethyl-2,3,4a,5,7,7a-hexahydro-1H-furo[3,4-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2,3,4a,5,7,7a-hexahydro-1H-furo[3,4-b]pyrazine?
The IUPAC name of 4-ethyl-2,3,4a,5,7,7a-hexahydro-1H-furo[3,4-b]pyrazine (CID 170737886) is 4-ethyl-2,3,4a,5,7,7a-hexahydro-1H-furo[3,4-b]pyrazine.
What is the SMILES notation for 4-ethyl-2,3,4a,5,7,7a-hexahydro-1H-furo[3,4-b]pyrazine?
The canonical SMILES for 4-ethyl-2,3,4a,5,7,7a-hexahydro-1H-furo[3,4-b]pyrazine is CCN1CCNC2COCC21.
What is the InChIKey of 4-ethyl-2,3,4a,5,7,7a-hexahydro-1H-furo[3,4-b]pyrazine?
The InChIKey is SSXCHKVSHBICTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O/c1-2-10-4-3-9-7-5-11-6-8(7)10/h7-9H,2-6H2,1H3.
What are the key properties of 4-ethyl-2,3,4a,5,7,7a-hexahydro-1H-furo[3,4-b]pyrazine?
4-ethyl-2,3,4a,5,7,7a-hexahydro-1H-furo[3,4-b]pyrazine has a molecular weight of 156.23 g/mol, XLogP of -0.32, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2,3,4a,5,7,7a-hexahydro-1H-furo[3,4-b]pyrazine is sourced from PubChem (CID 170737886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).