C16H25N3O — CID 167973729
(4aR,7aS)-4-[(2-methyl-6-propan-2-yl-3-pyridinyl)methyl]-2,3,4a,5,7,7a-hexahydro-1H-furo[3,4-b]pyrazine (PubChem CID 167973729) has the molecular formula C16H25N3O and a molecular weight of 275.40 g/mol. Its IUPAC name is (4aR,7aS)-4-[(2-methyl-6-propan-2-yl-3-pyridinyl)methyl]-2,3,4a,5,7,7a-hexahydro-1H-furo[3,4-b]pyrazine.
| Compound Name | (4aR,7aS)-4-[(2-methyl-6-propan-2-yl-3-pyridinyl)methyl]-2,3,4a,5,7,7a-hexahydro-1H-furo[3,4-b]pyrazine |
|---|---|
| PubChem CID | 167973729 |
| Molecular Formula | C16H25N3O |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | (4aR,7aS)-4-[(2-methyl-6-propan-2-yl-3-pyridinyl)methyl]-2,3,4a,5,7,7a-hexahydro-1H-furo[3,4-b]pyrazine |
| SMILES | Cc1nc(C(C)C)ccc1CN1CCN[C@@H]2COC[C@@H]21 |
| InChI | InChI=1S/C16H25N3O/c1-11(2)14-5-4-13(12(3)18-14)8-19-7-6-17-15-9-20-10-16(15)19/h4-5,11,15-17H,6-10H2,1-3H3/t15-,16+/m1/s1 |
| InChIKey | AJEZGONCLWQAJZ-CVEARBPZSA-N |
| XLogP | 1.69 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |