C14H22Cl2N2O2S — CID 112706821
(4aS,7aR)-4-[(4-methylphenyl)methyl]-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazine 6,6-dioxide;dihydrochloride (PubChem CID 112706821) has the molecular formula C14H22Cl2N2O2S and a molecular weight of 353.32 g/mol. Its IUPAC name is (4aS,7aR)-4-[(4-methylphenyl)methyl]-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazine 6,6-dioxide;dihydrochloride.
| Compound Name | (4aS,7aR)-4-[(4-methylphenyl)methyl]-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazine 6,6-dioxide;dihydrochloride |
|---|---|
| PubChem CID | 112706821 |
| Molecular Formula | C14H22Cl2N2O2S |
| Molecular Weight | 353.32 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | (4aS,7aR)-4-[(4-methylphenyl)methyl]-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazine 6,6-dioxide;dihydrochloride |
| SMILES | Cc1ccc(CN2CCN[C@H]3CS(=O)(=O)C[C@H]32)cc1.Cl.Cl |
| InChI | InChI=1S/C14H20N2O2S.2ClH/c1-11-2-4-12(5-3-11)8-16-7-6-15-13-9-19(17,18)10-14(13)16;;/h2-5,13-15H,6-10H2,1H3;2*1H/t13-,14+;;/m0../s1 |
| InChIKey | OWMYXVZSCUASKS-WICJZZOFSA-N |
| XLogP | 1.41 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.32 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |