C15H21N3O6S — CID 133121619
methyl 5-[[[2-[(4aR,7aS)-6,6-dioxo-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazin-4-yl]acetyl]amino]methyl]furan-2-carboxylate (PubChem CID 133121619) has the molecular formula C15H21N3O6S and a molecular weight of 371.42 g/mol. Its IUPAC name is methyl 5-[[[2-[(4aR,7aS)-6,6-dioxo-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazin-4-yl]acetyl]amino]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[[2-[(4aR,7aS)-6,6-dioxo-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazin-4-yl]acetyl]amino]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 133121619 |
| Molecular Formula | C15H21N3O6S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | methyl 5-[[[2-[(4aR,7aS)-6,6-dioxo-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazin-4-yl]acetyl]amino]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CNC(=O)CN2CCN[C@@H]3CS(=O)(=O)C[C@@H]32)o1 |
| InChI | InChI=1S/C15H21N3O6S/c1-23-15(20)13-3-2-10(24-13)6-17-14(19)7-18-5-4-16-11-8-25(21,22)9-12(11)18/h2-3,11-12,16H,4-9H2,1H3,(H,17,19)/t11-,12+/m1/s1 |
| InChIKey | KCKAXLBXOMNHFQ-NEPJUHHUSA-N |
| XLogP | -1.25 |
| TPSA | 117.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |