C13H16N2 — CID 166147038
2-ethyl-6-propan-2-yl-1,5-naphthyridine (PubChem CID 166147038) has the molecular formula C13H16N2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 2-ethyl-6-propan-2-yl-1,5-naphthyridine.
| Compound Name | 2-ethyl-6-propan-2-yl-1,5-naphthyridine |
|---|---|
| PubChem CID | 166147038 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 2-ethyl-6-propan-2-yl-1,5-naphthyridine |
| SMILES | CCc1ccc2nc(C(C)C)ccc2n1 |
| InChI | InChI=1S/C13H16N2/c1-4-10-5-6-13-12(14-10)8-7-11(15-13)9(2)3/h5-9H,4H2,1-3H3 |
| InChIKey | IJIKZNQOPIFMFD-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |