C16H20N4O3 — CID 171406838
1-[4-[(4aS,7aR)-2,3,4a,5,7,7a-hexahydro-1H-furo[3,4-b]pyrazin-4-yl]phenyl]-1,3-diazinane-2,4-dione (PubChem CID 171406838) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is 1-[4-[(4aS,7aR)-2,3,4a,5,7,7a-hexahydro-1H-furo[3,4-b]pyrazin-4-yl]phenyl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[4-[(4aS,7aR)-2,3,4a,5,7,7a-hexahydro-1H-furo[3,4-b]pyrazin-4-yl]phenyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 171406838 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 1-[4-[(4aS,7aR)-2,3,4a,5,7,7a-hexahydro-1H-furo[3,4-b]pyrazin-4-yl]phenyl]-1,3-diazinane-2,4-dione |
| SMILES | O=C1CCN(c2ccc(N3CCN[C@H]4COC[C@H]43)cc2)C(=O)N1 |
| InChI | InChI=1S/C16H20N4O3/c21-15-5-7-20(16(22)18-15)12-3-1-11(2-4-12)19-8-6-17-13-9-23-10-14(13)19/h1-4,13-14,17H,5-10H2,(H,18,21,22)/t13-,14+/m0/s1 |
| InChIKey | IHGSWJBONLONDZ-UONOGXRCSA-N |
| XLogP | 0.31 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |