C11H12IN2O2- — CID 156707562
1-(4-methyliodanuidylphenyl)-1,3-diazinane-2,4-dione (PubChem CID 156707562) has the molecular formula C11H12IN2O2- and a molecular weight of 331.13 g/mol. Its IUPAC name is 1-(4-methyliodanuidylphenyl)-1,3-diazinane-2,4-dione.
| Compound Name | 1-(4-methyliodanuidylphenyl)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 156707562 |
| Molecular Formula | C11H12IN2O2- |
| Molecular Weight | 331.13 g/mol |
| Exact Mass | 330.99 |
| IUPAC Name | 1-(4-methyliodanuidylphenyl)-1,3-diazinane-2,4-dione |
| SMILES | C[I-]c1ccc(N2CCC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C11H12IN2O2/c1-12-8-2-4-9(5-3-8)14-7-6-10(15)13-11(14)16/h2-5H,6-7H2,1H3,(H,13,15,16)/q-1 |
| InChIKey | BLJYTRQEEDAEIS-UHFFFAOYSA-N |
| XLogP | -1.98 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.13 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|