C10H14IN3O — CID 118069335
(2R,6S)-10-ethyl-11-iodo-4-oxa-1,7,12-triazatricyclo[7.3.0.02,6]dodeca-9,11-diene (PubChem CID 118069335) has the molecular formula C10H14IN3O and a molecular weight of 319.15 g/mol. Its IUPAC name is (2R,6S)-10-ethyl-11-iodo-4-oxa-1,7,12-triazatricyclo[7.3.0.02,6]dodeca-9,11-diene.
| Compound Name | (2R,6S)-10-ethyl-11-iodo-4-oxa-1,7,12-triazatricyclo[7.3.0.02,6]dodeca-9,11-diene |
|---|---|
| PubChem CID | 118069335 |
| Molecular Formula | C10H14IN3O |
| Molecular Weight | 319.15 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | (2R,6S)-10-ethyl-11-iodo-4-oxa-1,7,12-triazatricyclo[7.3.0.02,6]dodeca-9,11-diene |
| SMILES | CCc1c(I)nn2c1CN[C@@H]1COC[C@@H]12 |
| InChI | InChI=1S/C10H14IN3O/c1-2-6-8-3-12-7-4-15-5-9(7)14(8)13-10(6)11/h7,9,12H,2-5H2,1H3/t7-,9+/m1/s1 |
| InChIKey | RMLYBCKUCSCTEV-APPZFPTMSA-N |
| XLogP | 1.09 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.15 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|