C10H14IN3O — CID 118069328
1-(6-ethyl-2-iodo-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-3-yl)ethanone (PubChem CID 118069328) has the molecular formula C10H14IN3O and a molecular weight of 319.15 g/mol. Its IUPAC name is 1-(6-ethyl-2-iodo-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-3-yl)ethanone.
| Compound Name | 1-(6-ethyl-2-iodo-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-3-yl)ethanone |
|---|---|
| PubChem CID | 118069328 |
| Molecular Formula | C10H14IN3O |
| Molecular Weight | 319.15 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 1-(6-ethyl-2-iodo-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-3-yl)ethanone |
| SMILES | CCC1Cn2nc(I)c(C(C)=O)c2CN1 |
| InChI | InChI=1S/C10H14IN3O/c1-3-7-5-14-8(4-12-7)9(6(2)15)10(11)13-14/h7,12H,3-5H2,1-2H3 |
| InChIKey | ZJVZFDZVPDMKPP-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.15 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|