C12H22N4O2S — CID 64978298
2,5-diethyl-1-[(5-methyl-1H-pyrazol-4-yl)sulfonyl]piperazine (PubChem CID 64978298) has the molecular formula C12H22N4O2S and a molecular weight of 286.40 g/mol. Its IUPAC name is 2,5-diethyl-1-[(5-methyl-1H-pyrazol-4-yl)sulfonyl]piperazine.
| Compound Name | 2,5-diethyl-1-[(5-methyl-1H-pyrazol-4-yl)sulfonyl]piperazine |
|---|---|
| PubChem CID | 64978298 |
| Molecular Formula | C12H22N4O2S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 2,5-diethyl-1-[(5-methyl-1H-pyrazol-4-yl)sulfonyl]piperazine |
| SMILES | CCC1CN(S(=O)(=O)c2cn[nH]c2C)C(CC)CN1 |
| InChI | InChI=1S/C12H22N4O2S/c1-4-10-8-16(11(5-2)6-13-10)19(17,18)12-7-14-15-9(12)3/h7,10-11,13H,4-6,8H2,1-3H3,(H,14,15) |
| InChIKey | GAXDVVXWOGYHGO-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |