C9H18F2N2O2S — CID 64978816
1-(difluoromethylsulfonyl)-2,5-diethylpiperazine (PubChem CID 64978816) has the molecular formula C9H18F2N2O2S and a molecular weight of 256.32 g/mol. Its IUPAC name is 1-(difluoromethylsulfonyl)-2,5-diethylpiperazine.
| Compound Name | 1-(difluoromethylsulfonyl)-2,5-diethylpiperazine |
|---|---|
| PubChem CID | 64978816 |
| Molecular Formula | C9H18F2N2O2S |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 1-(difluoromethylsulfonyl)-2,5-diethylpiperazine |
| SMILES | CCC1CN(S(=O)(=O)C(F)F)C(CC)CN1 |
| InChI | InChI=1S/C9H18F2N2O2S/c1-3-7-6-13(8(4-2)5-12-7)16(14,15)9(10)11/h7-9,12H,3-6H2,1-2H3 |
| InChIKey | NGTPRVBNONRDCV-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |