3-(2,5-diethylpiperazin-1-yl)butanoic acid

C12H24N2O2 — CID 64979155

IUPAC3-(2,5-diethylpiperazin-1-yl)butanoic acid
SMILESCCC1CN(C(C)CC(=O)O)C(CC)CN1
InChIInChI=1S/C12H24N2O2/c1-4-10-8-14(9(3)6-12(15)16)11(5-2)7-13-10/h9-11,13H,4-8H2,1-3H3,(H,15,16)
InChIKeyCKGYMGZOANAUIN-UHFFFAOYSA-N
MW228.34 g/mol
LogP1.31
Rot. Bonds5

About 3-(2,5-diethylpiperazin-1-yl)butanoic acid

3-(2,5-diethylpiperazin-1-yl)butanoic acid (PubChem CID 64979155) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 3-(2,5-diethylpiperazin-1-yl)butanoic acid.

Molecular Properties

Compound Name3-(2,5-diethylpiperazin-1-yl)butanoic acid
PubChem CID64979155
Molecular FormulaC12H24N2O2
Molecular Weight228.34 g/mol
Exact Mass228.18
IUPAC Name3-(2,5-diethylpiperazin-1-yl)butanoic acid
SMILESCCC1CN(C(C)CC(=O)O)C(CC)CN1
InChIInChI=1S/C12H24N2O2/c1-4-10-8-14(9(3)6-12(15)16)11(5-2)7-13-10/h9-11,13H,4-8H2,1-3H3,(H,15,16)
InChIKeyCKGYMGZOANAUIN-UHFFFAOYSA-N
XLogP1.31
TPSA52.57 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.34
LogP ≤ 51.31
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3-(2,5-diethylpiperazin-1-yl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,5-diethylpiperazin-1-yl)butanoic acid?
The IUPAC name of 3-(2,5-diethylpiperazin-1-yl)butanoic acid (CID 64979155) is 3-(2,5-diethylpiperazin-1-yl)butanoic acid.
What is the SMILES notation for 3-(2,5-diethylpiperazin-1-yl)butanoic acid?
The canonical SMILES for 3-(2,5-diethylpiperazin-1-yl)butanoic acid is CCC1CN(C(C)CC(=O)O)C(CC)CN1.
What is the InChIKey of 3-(2,5-diethylpiperazin-1-yl)butanoic acid?
The InChIKey is CKGYMGZOANAUIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O2/c1-4-10-8-14(9(3)6-12(15)16)11(5-2)7-13-10/h9-11,13H,4-8H2,1-3H3,(H,15,16).
What are the key properties of 3-(2,5-diethylpiperazin-1-yl)butanoic acid?
3-(2,5-diethylpiperazin-1-yl)butanoic acid has a molecular weight of 228.34 g/mol, XLogP of 1.31, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-diethylpiperazin-1-yl)butanoic acid is sourced from PubChem (CID 64979155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).