C14H30N2 — CID 64947739
2,5-diethyl-1-hexan-2-ylpiperazine (PubChem CID 64947739) has the molecular formula C14H30N2 and a molecular weight of 226.41 g/mol. Its IUPAC name is 2,5-diethyl-1-hexan-2-ylpiperazine.
| Compound Name | 2,5-diethyl-1-hexan-2-ylpiperazine |
|---|---|
| PubChem CID | 64947739 |
| Molecular Formula | C14H30N2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.24 |
| IUPAC Name | 2,5-diethyl-1-hexan-2-ylpiperazine |
| SMILES | CCCCC(C)N1CC(CC)NCC1CC |
| InChI | InChI=1S/C14H30N2/c1-5-8-9-12(4)16-11-13(6-2)15-10-14(16)7-3/h12-15H,5-11H2,1-4H3 |
| InChIKey | NHUPTEPCTRCVTI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |