C12H27N3O2S — CID 64978285
N,N,2,5-tetraethylpiperazine-1-sulfonamide (PubChem CID 64978285) has the molecular formula C12H27N3O2S and a molecular weight of 277.43 g/mol. Its IUPAC name is N,N,2,5-tetraethylpiperazine-1-sulfonamide.
| Compound Name | N,N,2,5-tetraethylpiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 64978285 |
| Molecular Formula | C12H27N3O2S |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | N,N,2,5-tetraethylpiperazine-1-sulfonamide |
| SMILES | CCC1CN(S(=O)(=O)N(CC)CC)C(CC)CN1 |
| InChI | InChI=1S/C12H27N3O2S/c1-5-11-10-15(12(6-2)9-13-11)18(16,17)14(7-3)8-4/h11-13H,5-10H2,1-4H3 |
| InChIKey | IYHGIUYNHPZXJW-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |