C14H20Br2N2O2S — CID 64978223
1-(2,4-dibromophenyl)sulfonyl-2,5-diethylpiperazine (PubChem CID 64978223) has the molecular formula C14H20Br2N2O2S and a molecular weight of 440.20 g/mol. Its IUPAC name is 1-(2,4-dibromophenyl)sulfonyl-2,5-diethylpiperazine.
| Compound Name | 1-(2,4-dibromophenyl)sulfonyl-2,5-diethylpiperazine |
|---|---|
| PubChem CID | 64978223 |
| Molecular Formula | C14H20Br2N2O2S |
| Molecular Weight | 440.20 g/mol |
| Exact Mass | 437.96 |
| IUPAC Name | 1-(2,4-dibromophenyl)sulfonyl-2,5-diethylpiperazine |
| SMILES | CCC1CN(S(=O)(=O)c2ccc(Br)cc2Br)C(CC)CN1 |
| InChI | InChI=1S/C14H20Br2N2O2S/c1-3-11-9-18(12(4-2)8-17-11)21(19,20)14-6-5-10(15)7-13(14)16/h5-7,11-12,17H,3-4,8-9H2,1-2H3 |
| InChIKey | TTZZROFCBCXGSG-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.20 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |