C13H21N3O3S — CID 79553067
1-[1-[(5-methyl-1H-pyrazol-4-yl)sulfonyl]azepan-2-yl]propan-2-one (PubChem CID 79553067) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is 1-[1-[(5-methyl-1H-pyrazol-4-yl)sulfonyl]azepan-2-yl]propan-2-one.
| Compound Name | 1-[1-[(5-methyl-1H-pyrazol-4-yl)sulfonyl]azepan-2-yl]propan-2-one |
|---|---|
| PubChem CID | 79553067 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 1-[1-[(5-methyl-1H-pyrazol-4-yl)sulfonyl]azepan-2-yl]propan-2-one |
| SMILES | CC(=O)CC1CCCCCN1S(=O)(=O)c1cn[nH]c1C |
| InChI | InChI=1S/C13H21N3O3S/c1-10(17)8-12-6-4-3-5-7-16(12)20(18,19)13-9-14-15-11(13)2/h9,12H,3-8H2,1-2H3,(H,14,15) |
| InChIKey | LONVINLGXVWWEK-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |