About 1-[1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]azepan-2-yl]propan-2-one
1-[1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]azepan-2-yl]propan-2-one (PubChem CID 79541168) has the molecular formula C14H23N3O3S
and a molecular weight of 313.42 g/mol. Its IUPAC name is 1-[1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]azepan-2-yl]propan-2-one.
Molecular Properties
| Compound Name | 1-[1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]azepan-2-yl]propan-2-one |
| PubChem CID | 79541168 |
| Molecular Formula | C14H23N3O3S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 1-[1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]azepan-2-yl]propan-2-one |
| SMILES | CC(=O)CC1CCCCCN1S(=O)(=O)c1c(C)n[nH]c1C |
| InChI | InChI=1S/C14H23N3O3S/c1-10(18)9-13-7-5-4-6-8-17(13)21(19,20)14-11(2)15-16-12(14)3/h13H,4-9H2,1-3H3,(H,15,16) |
| InChIKey | HDPIHDRBSGIUKL-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]azepan-2-yl]propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]azepan-2-yl]propan-2-one?
The IUPAC name of 1-[1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]azepan-2-yl]propan-2-one (CID 79541168) is 1-[1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]azepan-2-yl]propan-2-one.
What is the SMILES notation for 1-[1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]azepan-2-yl]propan-2-one?
The canonical SMILES for 1-[1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]azepan-2-yl]propan-2-one is CC(=O)CC1CCCCCN1S(=O)(=O)c1c(C)n[nH]c1C.
What is the InChIKey of 1-[1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]azepan-2-yl]propan-2-one?
The InChIKey is HDPIHDRBSGIUKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3O3S/c1-10(18)9-13-7-5-4-6-8-17(13)21(19,20)14-11(2)15-16-12(14)3/h13H,4-9H2,1-3H3,(H,15,16).
What are the key properties of 1-[1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]azepan-2-yl]propan-2-one?
1-[1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]azepan-2-yl]propan-2-one has a molecular weight of 313.42 g/mol, XLogP of 1.94, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]azepan-2-yl]propan-2-one is sourced from PubChem (CID 79541168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).