C13H23N3O3S — CID 83057456
[5-methyl-4-(2-propylpiperidin-1-yl)sulfonyl-1H-pyrazol-3-yl]methanol (PubChem CID 83057456) has the molecular formula C13H23N3O3S and a molecular weight of 301.41 g/mol. Its IUPAC name is [5-methyl-4-(2-propylpiperidin-1-yl)sulfonyl-1H-pyrazol-3-yl]methanol.
| Compound Name | [5-methyl-4-(2-propylpiperidin-1-yl)sulfonyl-1H-pyrazol-3-yl]methanol |
|---|---|
| PubChem CID | 83057456 |
| Molecular Formula | C13H23N3O3S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | [5-methyl-4-(2-propylpiperidin-1-yl)sulfonyl-1H-pyrazol-3-yl]methanol |
| SMILES | CCCC1CCCCN1S(=O)(=O)c1c(CO)n[nH]c1C |
| InChI | InChI=1S/C13H23N3O3S/c1-3-6-11-7-4-5-8-16(11)20(18,19)13-10(2)14-15-12(13)9-17/h11,17H,3-9H2,1-2H3,(H,14,15) |
| InChIKey | JCWMSPCXELRRFG-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |