C11H19N3O2S — CID 55039995
2,3-dimethyl-1-[(5-methyl-1H-pyrazol-4-yl)sulfonyl]piperidine (PubChem CID 55039995) has the molecular formula C11H19N3O2S and a molecular weight of 257.36 g/mol. Its IUPAC name is 2,3-dimethyl-1-[(5-methyl-1H-pyrazol-4-yl)sulfonyl]piperidine.
| Compound Name | 2,3-dimethyl-1-[(5-methyl-1H-pyrazol-4-yl)sulfonyl]piperidine |
|---|---|
| PubChem CID | 55039995 |
| Molecular Formula | C11H19N3O2S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 2,3-dimethyl-1-[(5-methyl-1H-pyrazol-4-yl)sulfonyl]piperidine |
| SMILES | Cc1[nH]ncc1S(=O)(=O)N1CCCC(C)C1C |
| InChI | InChI=1S/C11H19N3O2S/c1-8-5-4-6-14(10(8)3)17(15,16)11-7-12-13-9(11)2/h7-8,10H,4-6H2,1-3H3,(H,12,13) |
| InChIKey | MQIPUKIOAMQMNS-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |