About (2R)-2-ethyl-4-methyl-1,4-diazepan-5-one
(2R)-2-ethyl-4-methyl-1,4-diazepan-5-one (PubChem CID 58093300) has the molecular formula C8H16N2O
and a molecular weight of 156.23 g/mol. Its IUPAC name is (2R)-2-ethyl-4-methyl-1,4-diazepan-5-one.
Molecular Properties
| Compound Name | (2R)-2-ethyl-4-methyl-1,4-diazepan-5-one |
| PubChem CID | 58093300 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | (2R)-2-ethyl-4-methyl-1,4-diazepan-5-one |
| SMILES | CC[C@@H]1CN(C)C(=O)CCN1 |
| InChI | InChI=1S/C8H16N2O/c1-3-7-6-10(2)8(11)4-5-9-7/h7,9H,3-6H2,1-2H3/t7-/m1/s1 |
| InChIKey | XNTVMOBEPLCVQX-SSDOTTSWSA-N |
| XLogP | 0.22 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-2-ethyl-4-methyl-1,4-diazepan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-ethyl-4-methyl-1,4-diazepan-5-one?
The IUPAC name of (2R)-2-ethyl-4-methyl-1,4-diazepan-5-one (CID 58093300) is (2R)-2-ethyl-4-methyl-1,4-diazepan-5-one.
What is the SMILES notation for (2R)-2-ethyl-4-methyl-1,4-diazepan-5-one?
The canonical SMILES for (2R)-2-ethyl-4-methyl-1,4-diazepan-5-one is CC[C@@H]1CN(C)C(=O)CCN1.
What is the InChIKey of (2R)-2-ethyl-4-methyl-1,4-diazepan-5-one?
The InChIKey is XNTVMOBEPLCVQX-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H16N2O/c1-3-7-6-10(2)8(11)4-5-9-7/h7,9H,3-6H2,1-2H3/t7-/m1/s1.
What are the key properties of (2R)-2-ethyl-4-methyl-1,4-diazepan-5-one?
(2R)-2-ethyl-4-methyl-1,4-diazepan-5-one has a molecular weight of 156.23 g/mol, XLogP of 0.22, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-ethyl-4-methyl-1,4-diazepan-5-one is sourced from PubChem (CID 58093300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).