C7H14N2O — CID 129371680
(2R)-2,4-dimethyl-1,4-diazepan-5-one (PubChem CID 129371680) has the molecular formula C7H14N2O and a molecular weight of 142.20 g/mol. Its IUPAC name is (2R)-2,4-dimethyl-1,4-diazepan-5-one.
| Compound Name | (2R)-2,4-dimethyl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 129371680 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | (2R)-2,4-dimethyl-1,4-diazepan-5-one |
| SMILES | C[C@@H]1CN(C)C(=O)CCN1 |
| InChI | InChI=1S/C7H14N2O/c1-6-5-9(2)7(10)3-4-8-6/h6,8H,3-5H2,1-2H3/t6-/m1/s1 |
| InChIKey | GMUFZZGGECBECZ-ZCFIWIBFSA-N |
| XLogP | -0.17 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |