About 1,5-dimethyl-1,3-diazinan-2-one
1,5-dimethyl-1,3-diazinan-2-one (PubChem CID 51000285) has the molecular formula C6H12N2O
and a molecular weight of 128.17 g/mol. Its IUPAC name is 1,5-dimethyl-1,3-diazinan-2-one.
Molecular Properties
| Compound Name | 1,5-dimethyl-1,3-diazinan-2-one |
| PubChem CID | 51000285 |
| Molecular Formula | C6H12N2O |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.09 |
| IUPAC Name | 1,5-dimethyl-1,3-diazinan-2-one |
| SMILES | CC1CNC(=O)N(C)C1 |
| InChI | InChI=1S/C6H12N2O/c1-5-3-7-6(9)8(2)4-5/h5H,3-4H2,1-2H3,(H,7,9) |
| InChIKey | JXLBOVNBPLHYNZ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,5-dimethyl-1,3-diazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dimethyl-1,3-diazinan-2-one?
The IUPAC name of 1,5-dimethyl-1,3-diazinan-2-one (CID 51000285) is 1,5-dimethyl-1,3-diazinan-2-one.
What is the SMILES notation for 1,5-dimethyl-1,3-diazinan-2-one?
The canonical SMILES for 1,5-dimethyl-1,3-diazinan-2-one is CC1CNC(=O)N(C)C1.
What is the InChIKey of 1,5-dimethyl-1,3-diazinan-2-one?
The InChIKey is JXLBOVNBPLHYNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O/c1-5-3-7-6(9)8(2)4-5/h5H,3-4H2,1-2H3,(H,7,9).
What are the key properties of 1,5-dimethyl-1,3-diazinan-2-one?
1,5-dimethyl-1,3-diazinan-2-one has a molecular weight of 128.17 g/mol, XLogP of 0.28, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dimethyl-1,3-diazinan-2-one is sourced from PubChem (CID 51000285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).