C9H20N2O — CID 154694196
ethane;1,3,5-trimethyl-1,3-diazinan-2-one (PubChem CID 154694196) has the molecular formula C9H20N2O and a molecular weight of 172.27 g/mol. Its IUPAC name is ethane;1,3,5-trimethyl-1,3-diazinan-2-one.
| Compound Name | ethane;1,3,5-trimethyl-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 154694196 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | ethane;1,3,5-trimethyl-1,3-diazinan-2-one |
| SMILES | CC.CC1CN(C)C(=O)N(C)C1 |
| InChI | InChI=1S/C7H14N2O.C2H6/c1-6-4-8(2)7(10)9(3)5-6;1-2/h6H,4-5H2,1-3H3;1-2H3 |
| InChIKey | BDPVKENSYQMVGJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |