C10H23NO — CID 142056309
1,3-dimethylpyrrolidin-2-one;ethane (PubChem CID 142056309) has the molecular formula C10H23NO and a molecular weight of 173.30 g/mol. Its IUPAC name is 1,3-dimethylpyrrolidin-2-one;ethane.
| Compound Name | 1,3-dimethylpyrrolidin-2-one;ethane |
|---|---|
| PubChem CID | 142056309 |
| Molecular Formula | C10H23NO |
| Molecular Weight | 173.30 g/mol |
| Exact Mass | 173.18 |
| IUPAC Name | 1,3-dimethylpyrrolidin-2-one;ethane |
| SMILES | CC.CC.CC1CCN(C)C1=O |
| InChI | InChI=1S/C6H11NO.2C2H6/c1-5-3-4-7(2)6(5)8;2*1-2/h5H,3-4H2,1-2H3;2*1-2H3 |
| InChIKey | NRMGPFHHSVIMCT-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.30 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |