C8H17NO — CID 144550831
(3S)-1,3-dimethylpyrrolidin-2-one;ethane (PubChem CID 144550831) has the molecular formula C8H17NO and a molecular weight of 143.23 g/mol. Its IUPAC name is (3S)-1,3-dimethylpyrrolidin-2-one;ethane.
| Compound Name | (3S)-1,3-dimethylpyrrolidin-2-one;ethane |
|---|---|
| PubChem CID | 144550831 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | (3S)-1,3-dimethylpyrrolidin-2-one;ethane |
| SMILES | CC.C[C@H]1CCN(C)C1=O |
| InChI | InChI=1S/C6H11NO.C2H6/c1-5-3-4-7(2)6(5)8;1-2/h5H,3-4H2,1-2H3;1-2H3/t5-;/m0./s1 |
| InChIKey | BHSQKQYZEYAUBY-JEDNCBNOSA-N |
| XLogP | 1.51 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |