C9H17N3O — CID 112546349
5-methyl-1-pyrrolidin-2-yl-1,3-diazinan-2-one (PubChem CID 112546349) has the molecular formula C9H17N3O and a molecular weight of 183.25 g/mol. Its IUPAC name is 5-methyl-1-pyrrolidin-2-yl-1,3-diazinan-2-one.
| Compound Name | 5-methyl-1-pyrrolidin-2-yl-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 112546349 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | 5-methyl-1-pyrrolidin-2-yl-1,3-diazinan-2-one |
| SMILES | CC1CNC(=O)N(C2CCCN2)C1 |
| InChI | InChI=1S/C9H17N3O/c1-7-5-11-9(13)12(6-7)8-3-2-4-10-8/h7-8,10H,2-6H2,1H3,(H,11,13) |
| InChIKey | CCZCXGWJTRBFSB-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |