C11H21N3O — CID 112546665
3,4-dimethyl-1-pyrrolidin-2-yl-1,4-diazepan-5-one (PubChem CID 112546665) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is 3,4-dimethyl-1-pyrrolidin-2-yl-1,4-diazepan-5-one.
| Compound Name | 3,4-dimethyl-1-pyrrolidin-2-yl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 112546665 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 3,4-dimethyl-1-pyrrolidin-2-yl-1,4-diazepan-5-one |
| SMILES | CC1CN(C2CCCN2)CCC(=O)N1C |
| InChI | InChI=1S/C11H21N3O/c1-9-8-14(10-4-3-6-12-10)7-5-11(15)13(9)2/h9-10,12H,3-8H2,1-2H3 |
| InChIKey | XWYZKQUFIZEURE-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |