C11H23N3 — CID 112546464
1,2-dimethyl-4-piperidin-2-ylpiperazine (PubChem CID 112546464) has the molecular formula C11H23N3 and a molecular weight of 197.33 g/mol. Its IUPAC name is 1,2-dimethyl-4-piperidin-2-ylpiperazine.
| Compound Name | 1,2-dimethyl-4-piperidin-2-ylpiperazine |
|---|---|
| PubChem CID | 112546464 |
| Molecular Formula | C11H23N3 |
| Molecular Weight | 197.33 g/mol |
| Exact Mass | 197.19 |
| IUPAC Name | 1,2-dimethyl-4-piperidin-2-ylpiperazine |
| SMILES | CC1CN(C2CCCCN2)CCN1C |
| InChI | InChI=1S/C11H23N3/c1-10-9-14(8-7-13(10)2)11-5-3-4-6-12-11/h10-12H,3-9H2,1-2H3 |
| InChIKey | AMHYHAWTELLNGM-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.33 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |