C6H13N3O — CID 83694375
5-(aminomethyl)-1-methyl-1,3-diazinan-2-one (PubChem CID 83694375) has the molecular formula C6H13N3O and a molecular weight of 143.19 g/mol. Its IUPAC name is 5-(aminomethyl)-1-methyl-1,3-diazinan-2-one.
| Compound Name | 5-(aminomethyl)-1-methyl-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 83694375 |
| Molecular Formula | C6H13N3O |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.11 |
| IUPAC Name | 5-(aminomethyl)-1-methyl-1,3-diazinan-2-one |
| SMILES | CN1CC(CN)CNC1=O |
| InChI | InChI=1S/C6H13N3O/c1-9-4-5(2-7)3-8-6(9)10/h5H,2-4,7H2,1H3,(H,8,10) |
| InChIKey | OVGDSFIVIKTHSC-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |