C9H20N2O2 — CID 143680577
6-(aminomethyl)-4-methyl-1,4-oxazepan-3-one;ethane (PubChem CID 143680577) has the molecular formula C9H20N2O2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 6-(aminomethyl)-4-methyl-1,4-oxazepan-3-one;ethane.
| Compound Name | 6-(aminomethyl)-4-methyl-1,4-oxazepan-3-one;ethane |
|---|---|
| PubChem CID | 143680577 |
| Molecular Formula | C9H20N2O2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.15 |
| IUPAC Name | 6-(aminomethyl)-4-methyl-1,4-oxazepan-3-one;ethane |
| SMILES | CC.CN1CC(CN)COCC1=O |
| InChI | InChI=1S/C7H14N2O2.C2H6/c1-9-3-6(2-8)4-11-5-7(9)10;1-2/h6H,2-5,8H2,1H3;1-2H3 |
| InChIKey | LLRARDPRYGTIQQ-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |