C12H14N2O3 — CID 105494158
4-(1-methyl-2-oxo-1,3-diazinan-5-yl)benzoic acid (PubChem CID 105494158) has the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. Its IUPAC name is 4-(1-methyl-2-oxo-1,3-diazinan-5-yl)benzoic acid.
| Compound Name | 4-(1-methyl-2-oxo-1,3-diazinan-5-yl)benzoic acid |
|---|---|
| PubChem CID | 105494158 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 4-(1-methyl-2-oxo-1,3-diazinan-5-yl)benzoic acid |
| SMILES | CN1CC(c2ccc(C(=O)O)cc2)CNC1=O |
| InChI | InChI=1S/C12H14N2O3/c1-14-7-10(6-13-12(14)17)8-2-4-9(5-3-8)11(15)16/h2-5,10H,6-7H2,1H3,(H,13,17)(H,15,16) |
| InChIKey | SIIMAGXVZHVDOF-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |