4-[(2S,5S)-5-methyl-3-oxopiperazin-2-yl]benzoic acid

C12H14N2O3 — CID 125457971

IUPAC4-[(2S,5S)-5-methyl-3-oxopiperazin-2-yl]benzoic acid
SMILESC[C@H]1CN[C@@H](c2ccc(C(=O)O)cc2)C(=O)N1
InChIInChI=1S/C12H14N2O3/c1-7-6-13-10(11(15)14-7)8-2-4-9(5-3-8)12(16)17/h2-5,7,10,13H,6H2,1H3,(H,14,15)(H,16,17)/t7-,10-/m0/s1
InChIKeyNBHJINSKEOWMNR-XVKPBYJWSA-N
MW234.25 g/mol
LogP0.53
Rot. Bonds2

About 4-[(2S,5S)-5-methyl-3-oxopiperazin-2-yl]benzoic acid

4-[(2S,5S)-5-methyl-3-oxopiperazin-2-yl]benzoic acid (PubChem CID 125457971) has the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. Its IUPAC name is 4-[(2S,5S)-5-methyl-3-oxopiperazin-2-yl]benzoic acid.

Molecular Properties

Compound Name4-[(2S,5S)-5-methyl-3-oxopiperazin-2-yl]benzoic acid
PubChem CID125457971
Molecular FormulaC12H14N2O3
Molecular Weight234.25 g/mol
Exact Mass234.10
IUPAC Name4-[(2S,5S)-5-methyl-3-oxopiperazin-2-yl]benzoic acid
SMILESC[C@H]1CN[C@@H](c2ccc(C(=O)O)cc2)C(=O)N1
InChIInChI=1S/C12H14N2O3/c1-7-6-13-10(11(15)14-7)8-2-4-9(5-3-8)12(16)17/h2-5,7,10,13H,6H2,1H3,(H,14,15)(H,16,17)/t7-,10-/m0/s1
InChIKeyNBHJINSKEOWMNR-XVKPBYJWSA-N
XLogP0.53
TPSA78.43 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500234.25
LogP ≤ 50.53
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 4-[(2S,5S)-5-methyl-3-oxopiperazin-2-yl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(2S,5S)-5-methyl-3-oxopiperazin-2-yl]benzoic acid?
The IUPAC name of 4-[(2S,5S)-5-methyl-3-oxopiperazin-2-yl]benzoic acid (CID 125457971) is 4-[(2S,5S)-5-methyl-3-oxopiperazin-2-yl]benzoic acid.
What is the SMILES notation for 4-[(2S,5S)-5-methyl-3-oxopiperazin-2-yl]benzoic acid?
The canonical SMILES for 4-[(2S,5S)-5-methyl-3-oxopiperazin-2-yl]benzoic acid is C[C@H]1CN[C@@H](c2ccc(C(=O)O)cc2)C(=O)N1.
What is the InChIKey of 4-[(2S,5S)-5-methyl-3-oxopiperazin-2-yl]benzoic acid?
The InChIKey is NBHJINSKEOWMNR-XVKPBYJWSA-N. The full InChI is InChI=1S/C12H14N2O3/c1-7-6-13-10(11(15)14-7)8-2-4-9(5-3-8)12(16)17/h2-5,7,10,13H,6H2,1H3,(H,14,15)(H,16,17)/t7-,10-/m0/s1.
What are the key properties of 4-[(2S,5S)-5-methyl-3-oxopiperazin-2-yl]benzoic acid?
4-[(2S,5S)-5-methyl-3-oxopiperazin-2-yl]benzoic acid has a molecular weight of 234.25 g/mol, XLogP of 0.53, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2S,5S)-5-methyl-3-oxopiperazin-2-yl]benzoic acid is sourced from PubChem (CID 125457971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).