C12H18N2 — CID 138981432
(3R)-1,3,6-trimethyl-2,3,4,5-tetrahydro-1,5-benzodiazepine (PubChem CID 138981432) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is (3R)-1,3,6-trimethyl-2,3,4,5-tetrahydro-1,5-benzodiazepine.
| Compound Name | (3R)-1,3,6-trimethyl-2,3,4,5-tetrahydro-1,5-benzodiazepine |
|---|---|
| PubChem CID | 138981432 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | (3R)-1,3,6-trimethyl-2,3,4,5-tetrahydro-1,5-benzodiazepine |
| SMILES | Cc1cccc2c1NC[C@@H](C)CN2C |
| InChI | InChI=1S/C12H18N2/c1-9-7-13-12-10(2)5-4-6-11(12)14(3)8-9/h4-6,9,13H,7-8H2,1-3H3/t9-/m1/s1 |
| InChIKey | QAAFNDQRBSNXFA-SECBINFHSA-N |
| XLogP | 2.49 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |